C8H10BrNO3 — CID 77078224
1-[2-(2-bromoethoxy)ethyl]pyrrole-2,5-dione (PubChem CID 77078224) has the molecular formula C8H10BrNO3 and a molecular weight of 248.08 g/mol. Its IUPAC name is 1-[2-(2-bromoethoxy)ethyl]pyrrole-2,5-dione.
| Compound Name | 1-[2-(2-bromoethoxy)ethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 77078224 |
| Molecular Formula | C8H10BrNO3 |
| Molecular Weight | 248.08 g/mol |
| Exact Mass | 246.98 |
| IUPAC Name | 1-[2-(2-bromoethoxy)ethyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CCOCCBr |
| InChI | InChI=1S/C8H10BrNO3/c9-3-5-13-6-4-10-7(11)1-2-8(10)12/h1-2H,3-6H2 |
| InChIKey | RMLXDIKYASQPNE-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.08 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|