C42H50N4O8S — CID 166715884
CID 166715884 (PubChem CID 166715884) has the molecular formula C42H50N4O8S and a molecular weight of 770.95 g/mol.
| Compound Name | CID 166715884 |
|---|---|
| PubChem CID | 166715884 |
| Molecular Formula | C42H50N4O8S |
| Molecular Weight | 770.95 g/mol |
| Exact Mass | 770.33 |
| IUPAC Name | — |
| SMILES | CN(C)c1ccc2c(c1)S1(CCCCC1)c1cc(N(C)C)ccc1C21OC(=O)c2ccc(C(=O)NCCOCCOCCOCCN3C(=O)C=CC3=O)cc21 |
| InChI | InChI=1S/C42H50N4O8S/c1-44(2)30-9-12-33-36(27-30)55(24-6-5-7-25-55)37-28-31(45(3)4)10-13-34(37)42(33)35-26-29(8-11-32(35)41(50)54-42)40(49)43-16-18-51-20-22-53-23-21-52-19-17-46-38(47)14-15-39(46)48/h8-15,26-28H,5-7,16-25H2,1-4H3,(H,43,49) |
| InChIKey | WPSLUFRVJODNOV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 126.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.95 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|