About CID 166715884
CID 166715884 (PubChem CID 166715884) has the molecular formula C42H50N4O8S
and a molecular weight of 770.95 g/mol.
Molecular Properties
| Compound Name | CID 166715884 |
| PubChem CID | 166715884 |
| Molecular Formula | C42H50N4O8S |
| Molecular Weight | 770.95 g/mol |
| Exact Mass | 770.33 |
| IUPAC Name | — |
| SMILES | CN(C)c1ccc2c(c1)S1(CCCCC1)c1cc(N(C)C)ccc1C21OC(=O)c2ccc(C(=O)NCCOCCOCCOCCN3C(=O)C=CC3=O)cc21 |
| InChI | InChI=1S/C42H50N4O8S/c1-44(2)30-9-12-33-36(27-30)55(24-6-5-7-25-55)37-28-31(45(3)4)10-13-34(37)42(33)35-26-29(8-11-32(35)41(50)54-42)40(49)43-16-18-51-20-22-53-23-21-52-19-17-46-38(47)14-15-39(46)48/h8-15,26-28H,5-7,16-25H2,1-4H3,(H,43,49) |
| InChIKey | WPSLUFRVJODNOV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 126.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 770.95 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze CID 166715884 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166715884?
The IUPAC name of CID 166715884 (CID 166715884) is not available.
What is the SMILES notation for CID 166715884?
The canonical SMILES for CID 166715884 is CN(C)c1ccc2c(c1)S1(CCCCC1)c1cc(N(C)C)ccc1C21OC(=O)c2ccc(C(=O)NCCOCCOCCOCCN3C(=O)C=CC3=O)cc21.
What is the InChIKey of CID 166715884?
The InChIKey is WPSLUFRVJODNOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C42H50N4O8S/c1-44(2)30-9-12-33-36(27-30)55(24-6-5-7-25-55)37-28-31(45(3)4)10-13-34(37)42(33)35-26-29(8-11-32(35)41(50)54-42)40(49)43-16-18-51-20-22-53-23-21-52-19-17-46-38(47)14-15-39(46)48/h8-15,26-28H,5-7,16-25H2,1-4H3,(H,43,49).
What are the key properties of CID 166715884?
CID 166715884 has a molecular weight of 770.95 g/mol, XLogP of 4.71, 15 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166715884 is sourced from PubChem (CID 166715884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).