C37H40N4O5Si — CID 157022976
CID 157022976 (PubChem CID 157022976) has the molecular formula C37H40N4O5Si and a molecular weight of 648.84 g/mol.
| Compound Name | CID 157022976 |
|---|---|
| PubChem CID | 157022976 |
| Molecular Formula | C37H40N4O5Si |
| Molecular Weight | 648.84 g/mol |
| Exact Mass | 648.28 |
| IUPAC Name | — |
| SMILES | Cc1cc2c(cc1C(=O)NCCN1C(=O)C=CC1=O)C1(OC2=O)c2ccc(N(C)C)cc2[Si]2(CCCCC2)c2cc(N(C)C)ccc21 |
| InChI | InChI=1S/C37H40N4O5Si/c1-23-19-27-30(22-26(23)35(44)38-15-16-41-33(42)13-14-34(41)43)37(46-36(27)45)28-11-9-24(39(2)3)20-31(28)47(17-7-6-8-18-47)32-21-25(40(4)5)10-12-29(32)37/h9-14,19-22H,6-8,15-18H2,1-5H3,(H,38,44) |
| InChIKey | IXYSPOPSTOGAHR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.84 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|