C25H24N3O4P — CID 145079760
3',6'-bis(dimethylamino)-1-oxo-N-phosphanylspiro[2-benzofuran-3,9'-xanthene]-5-carboxamide (PubChem CID 145079760) has the molecular formula C25H24N3O4P and a molecular weight of 461.46 g/mol. Its IUPAC name is 3',6'-bis(dimethylamino)-1-oxo-N-phosphanylspiro[2-benzofuran-3,9'-xanthene]-5-carboxamide.
| Compound Name | 3',6'-bis(dimethylamino)-1-oxo-N-phosphanylspiro[2-benzofuran-3,9'-xanthene]-5-carboxamide |
|---|---|
| PubChem CID | 145079760 |
| Molecular Formula | C25H24N3O4P |
| Molecular Weight | 461.46 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 3',6'-bis(dimethylamino)-1-oxo-N-phosphanylspiro[2-benzofuran-3,9'-xanthene]-5-carboxamide |
| SMILES | CN(C)c1ccc2c(c1)Oc1cc(N(C)C)ccc1C21OC(=O)c2ccc(C(=O)NP)cc21 |
| InChI | InChI=1S/C25H24N3O4P/c1-27(2)15-6-9-18-21(12-15)31-22-13-16(28(3)4)7-10-19(22)25(18)20-11-14(23(29)26-33)5-8-17(20)24(30)32-25/h5-13H,33H2,1-4H3,(H,26,29) |
| InChIKey | FQDSSBFDDRIISN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|