C34H31N3O5S — CID 102353647
S-benzyl 2-[[3',6'-bis(dimethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl]amino]ethanethioate (PubChem CID 102353647) has the molecular formula C34H31N3O5S and a molecular weight of 593.71 g/mol. Its IUPAC name is S-benzyl 2-[[3',6'-bis(dimethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl]amino]ethanethioate.
| Compound Name | S-benzyl 2-[[3',6'-bis(dimethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl]amino]ethanethioate |
|---|---|
| PubChem CID | 102353647 |
| Molecular Formula | C34H31N3O5S |
| Molecular Weight | 593.71 g/mol |
| Exact Mass | 593.20 |
| IUPAC Name | S-benzyl 2-[[3',6'-bis(dimethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl]amino]ethanethioate |
| SMILES | CN(C)c1ccc2c(c1)Oc1cc(N(C)C)ccc1C21OC(=O)c2cc(C(=O)NCC(=O)SCc3ccccc3)ccc21 |
| InChI | InChI=1S/C34H31N3O5S/c1-36(2)23-11-14-27-29(17-23)41-30-18-24(37(3)4)12-15-28(30)34(27)26-13-10-22(16-25(26)33(40)42-34)32(39)35-19-31(38)43-20-21-8-6-5-7-9-21/h5-18H,19-20H2,1-4H3,(H,35,39) |
| InChIKey | VHEGOGLNQNQVMM-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.71 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|