C28H26N2O10 — CID 137481418
2-[2-[2-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl)amino]ethoxy]ethoxy]ethylcarbamic acid (PubChem CID 137481418) has the molecular formula C28H26N2O10 and a molecular weight of 550.52 g/mol. Its IUPAC name is 2-[2-[2-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl)amino]ethoxy]ethoxy]ethylcarbamic acid.
| Compound Name | 2-[2-[2-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl)amino]ethoxy]ethoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 137481418 |
| Molecular Formula | C28H26N2O10 |
| Molecular Weight | 550.52 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | 2-[2-[2-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl)amino]ethoxy]ethoxy]ethylcarbamic acid |
| SMILES | O=C(O)NCCOCCOCCNC(=O)c1ccc2c(c1)C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C28H26N2O10/c31-17-2-5-21-23(14-17)39-24-15-18(32)3-6-22(24)28(21)20-4-1-16(13-19(20)26(34)40-28)25(33)29-7-9-37-11-12-38-10-8-30-27(35)36/h1-6,13-15,30-32H,7-12H2,(H,29,33)(H,35,36) |
| InChIKey | HDNQEEHQIFSJAD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 172.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.52 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|