C31H33N3O7S — CID 102365656
N-[(5S)-5-amino-6-oxo-6-(4-sulfanylbutylamino)hexyl]-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxamide (PubChem CID 102365656) has the molecular formula C31H33N3O7S and a molecular weight of 591.69 g/mol. Its IUPAC name is N-[(5S)-5-amino-6-oxo-6-(4-sulfanylbutylamino)hexyl]-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxamide.
| Compound Name | N-[(5S)-5-amino-6-oxo-6-(4-sulfanylbutylamino)hexyl]-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxamide |
|---|---|
| PubChem CID | 102365656 |
| Molecular Formula | C31H33N3O7S |
| Molecular Weight | 591.69 g/mol |
| Exact Mass | 591.20 |
| IUPAC Name | N-[(5S)-5-amino-6-oxo-6-(4-sulfanylbutylamino)hexyl]-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxamide |
| SMILES | N[C@@H](CCCCNC(=O)c1ccc2c(c1)C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21)C(=O)NCCCCS |
| InChI | InChI=1S/C31H33N3O7S/c32-25(29(38)34-13-3-4-14-42)5-1-2-12-33-28(37)18-6-9-22-21(15-18)30(39)41-31(22)23-10-7-19(35)16-26(23)40-27-17-20(36)8-11-24(27)31/h6-11,15-17,25,35-36,42H,1-5,12-14,32H2,(H,33,37)(H,34,38)/t25-/m0/s1 |
| InChIKey | DZJDLDZBLQZIDS-VWLOTQADSA-N |
| XLogP | 3.72 |
| TPSA | 160.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.69 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|