C36H42N3O12S+ — CID 121366839
3-(4-carboxybutanoylamino)propyl-[3-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl)amino]propyl]-methyl-(3-sulfopropyl)azanium (PubChem CID 121366839) has the molecular formula C36H42N3O12S+ and a molecular weight of 740.81 g/mol. Its IUPAC name is 3-(4-carboxybutanoylamino)propyl-[3-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl)amino]propyl]-methyl-(3-sulfopropyl)azanium.
| Compound Name | 3-(4-carboxybutanoylamino)propyl-[3-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl)amino]propyl]-methyl-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 121366839 |
| Molecular Formula | C36H42N3O12S+ |
| Molecular Weight | 740.81 g/mol |
| Exact Mass | 740.25 |
| IUPAC Name | 3-(4-carboxybutanoylamino)propyl-[3-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl)amino]propyl]-methyl-(3-sulfopropyl)azanium |
| SMILES | C[N+](CCCNC(=O)CCCC(=O)O)(CCCNC(=O)c1ccc2c(c1)C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21)CCCS(=O)(=O)O |
| InChI | InChI=1S/C36H41N3O12S/c1-39(18-5-19-52(47,48)49,16-3-14-37-32(42)6-2-7-33(43)44)17-4-15-38-34(45)23-8-11-27-26(20-23)35(46)51-36(27)28-12-9-24(40)21-30(28)50-31-22-25(41)10-13-29(31)36/h8-13,20-22H,2-7,14-19H2,1H3,(H5-,37,38,40,41,42,43,44,45,47,48,49)/p+1 |
| InChIKey | NRKGLGNXUUSZQW-UHFFFAOYSA-O |
| XLogP | 3.27 |
| TPSA | 225.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.81 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|