C39H40N3O11- — CID 171612005
4-[4-[[6-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl)amino]hexylamino]methyl]-2-methoxy-5-(oxidoamino)phenoxy]butanoic acid (PubChem CID 171612005) has the molecular formula C39H40N3O11- and a molecular weight of 726.76 g/mol. Its IUPAC name is 4-[4-[[6-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl)amino]hexylamino]methyl]-2-methoxy-5-(oxidoamino)phenoxy]butanoic acid.
| Compound Name | 4-[4-[[6-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl)amino]hexylamino]methyl]-2-methoxy-5-(oxidoamino)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 171612005 |
| Molecular Formula | C39H40N3O11- |
| Molecular Weight | 726.76 g/mol |
| Exact Mass | 726.27 |
| IUPAC Name | 4-[4-[[6-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl)amino]hexylamino]methyl]-2-methoxy-5-(oxidoamino)phenoxy]butanoic acid |
| SMILES | COc1cc(CNCCCCCCNC(=O)c2ccc3c(c2)C(=O)OC32c3ccc(O)cc3Oc3cc(O)ccc32)c(N[O-])cc1OCCCC(=O)O |
| InChI | InChI=1S/C39H40N3O11/c1-50-34-18-24(31(42-49)21-35(34)51-16-6-7-36(45)46)22-40-14-4-2-3-5-15-41-37(47)23-8-11-28-27(17-23)38(48)53-39(28)29-12-9-25(43)19-32(29)52-33-20-26(44)10-13-30(33)39/h8-13,17-21,40,42-44H,2-7,14-16,22H2,1H3,(H,41,47)(H,45,46)/q-1 |
| InChIKey | XOTHQZPJMLMFQH-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 207.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.76 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|