C36H37N3O7 — CID 169149845
4-(aminomethyl)benzaldehyde;3',6'-dihydroxy-N-[6-(methylamino)hexyl]-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxamide (PubChem CID 169149845) has the molecular formula C36H37N3O7 and a molecular weight of 623.71 g/mol. Its IUPAC name is 4-(aminomethyl)benzaldehyde;3',6'-dihydroxy-N-[6-(methylamino)hexyl]-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxamide.
| Compound Name | 4-(aminomethyl)benzaldehyde;3',6'-dihydroxy-N-[6-(methylamino)hexyl]-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxamide |
|---|---|
| PubChem CID | 169149845 |
| Molecular Formula | C36H37N3O7 |
| Molecular Weight | 623.71 g/mol |
| Exact Mass | 623.26 |
| IUPAC Name | 4-(aminomethyl)benzaldehyde;3',6'-dihydroxy-N-[6-(methylamino)hexyl]-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxamide |
| SMILES | CNCCCCCCNC(=O)c1ccc2c(c1)C1(OC2=O)c2ccc(O)cc2Oc2cc(O)ccc21.NCc1ccc(C=O)cc1 |
| InChI | InChI=1S/C28H28N2O6.C8H9NO/c1-29-12-4-2-3-5-13-30-26(33)17-6-9-20-23(14-17)28(36-27(20)34)21-10-7-18(31)15-24(21)35-25-16-19(32)8-11-22(25)28;9-5-7-1-3-8(6-10)4-2-7/h6-11,14-16,29,31-32H,2-5,12-13H2,1H3,(H,30,33);1-4,6H,5,9H2 |
| InChIKey | ASMHQEVJQYQFOQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 160.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.71 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|