C27H23IN2O7 — CID 88883607
(2S)-2-amino-6-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl)amino]hexanoyl iodide (PubChem CID 88883607) has the molecular formula C27H23IN2O7 and a molecular weight of 614.39 g/mol. Its IUPAC name is (2S)-2-amino-6-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl)amino]hexanoyl iodide.
| Compound Name | (2S)-2-amino-6-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl)amino]hexanoyl iodide |
|---|---|
| PubChem CID | 88883607 |
| Molecular Formula | C27H23IN2O7 |
| Molecular Weight | 614.39 g/mol |
| Exact Mass | 614.05 |
| IUPAC Name | (2S)-2-amino-6-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl)amino]hexanoyl iodide |
| SMILES | N[C@@H](CCCCNC(=O)c1ccc2c(c1)C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21)C(=O)I |
| InChI | InChI=1S/C27H23IN2O7/c28-24(33)21(29)3-1-2-10-30-25(34)14-4-7-18-17(11-14)26(35)37-27(18)19-8-5-15(31)12-22(19)36-23-13-16(32)6-9-20(23)27/h4-9,11-13,21,31-32H,1-3,10,29H2,(H,30,34)/t21-/m0/s1 |
| InChIKey | WKXCHTIBIDVHTL-NRFANRHFSA-N |
| XLogP | 3.85 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|