C22H14INO6 — CID 67249966
2-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-2-iodoacetamide (PubChem CID 67249966) has the molecular formula C22H14INO6 and a molecular weight of 515.26 g/mol. Its IUPAC name is 2-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-2-iodoacetamide.
| Compound Name | 2-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-2-iodoacetamide |
|---|---|
| PubChem CID | 67249966 |
| Molecular Formula | C22H14INO6 |
| Molecular Weight | 515.26 g/mol |
| Exact Mass | 514.99 |
| IUPAC Name | 2-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-2-iodoacetamide |
| SMILES | NC(=O)C(I)c1ccc2c(c1)C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C22H14INO6/c23-19(20(24)27)10-1-4-14-13(7-10)21(28)30-22(14)15-5-2-11(25)8-17(15)29-18-9-12(26)3-6-16(18)22/h1-9,19,25-26H,(H2,24,27) |
| InChIKey | XRVDKUQFRIYADB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.26 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|