C30H27NO9 — CID 131952964
3',6'-dihydroxy-3-oxo-N-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethyl]spiro[2-benzofuran-1,9'-xanthene]-5-carboxamide (PubChem CID 131952964) has the molecular formula C30H27NO9 and a molecular weight of 545.54 g/mol. Its IUPAC name is 3',6'-dihydroxy-3-oxo-N-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethyl]spiro[2-benzofuran-1,9'-xanthene]-5-carboxamide.
| Compound Name | 3',6'-dihydroxy-3-oxo-N-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethyl]spiro[2-benzofuran-1,9'-xanthene]-5-carboxamide |
|---|---|
| PubChem CID | 131952964 |
| Molecular Formula | C30H27NO9 |
| Molecular Weight | 545.54 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | 3',6'-dihydroxy-3-oxo-N-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethyl]spiro[2-benzofuran-1,9'-xanthene]-5-carboxamide |
| SMILES | C#CCOCCOCCOCCNC(=O)c1ccc2c(c1)C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C30H27NO9/c1-2-10-36-12-14-38-15-13-37-11-9-31-28(34)19-3-6-23-22(16-19)29(35)40-30(23)24-7-4-20(32)17-26(24)39-27-18-21(33)5-8-25(27)30/h1,3-8,16-18,32-33H,9-15H2,(H,31,34) |
| InChIKey | GRFURLCCGGOOIC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 132.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|