C24H17NO6S — CID 174608460
3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;O-prop-2-ynyl carbamothioate (PubChem CID 174608460) has the molecular formula C24H17NO6S and a molecular weight of 447.47 g/mol. Its IUPAC name is 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;O-prop-2-ynyl carbamothioate.
| Compound Name | 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;O-prop-2-ynyl carbamothioate |
|---|---|
| PubChem CID | 174608460 |
| Molecular Formula | C24H17NO6S |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;O-prop-2-ynyl carbamothioate |
| SMILES | C#CCOC(N)=S.O=C1OC2(c3ccc(O)cc3Oc3cc(O)ccc32)c2ccccc21 |
| InChI | InChI=1S/C20H12O5.C4H5NOS/c21-11-5-7-15-17(9-11)24-18-10-12(22)6-8-16(18)20(15)14-4-2-1-3-13(14)19(23)25-20;1-2-3-6-4(5)7/h1-10,21-22H;1H,3H2,(H2,5,7) |
| InChIKey | WJDJJKDEZVJJEF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|