C29H27NO11 — CID 10698201
3',6'-dihydroxy-1-oxo-N-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethyl]spiro[2-benzofuran-3,9'-xanthene]-5-carboxamide (PubChem CID 10698201) has the molecular formula C29H27NO11 and a molecular weight of 565.53 g/mol. Its IUPAC name is 3',6'-dihydroxy-1-oxo-N-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethyl]spiro[2-benzofuran-3,9'-xanthene]-5-carboxamide.
| Compound Name | 3',6'-dihydroxy-1-oxo-N-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethyl]spiro[2-benzofuran-3,9'-xanthene]-5-carboxamide |
|---|---|
| PubChem CID | 10698201 |
| Molecular Formula | C29H27NO11 |
| Molecular Weight | 565.53 g/mol |
| Exact Mass | 565.16 |
| IUPAC Name | 3',6'-dihydroxy-1-oxo-N-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethyl]spiro[2-benzofuran-3,9'-xanthene]-5-carboxamide |
| SMILES | O=C(NCC[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O)c1ccc2c(c1)C1(OC2=O)c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C29H27NO11/c31-12-23-25(35)26(36)24(34)20(39-23)7-8-30-27(37)13-1-4-16-19(9-13)29(41-28(16)38)17-5-2-14(32)10-21(17)40-22-11-15(33)3-6-18(22)29/h1-6,9-11,20,23-26,31-36H,7-8,12H2,(H,30,37)/t20-,23-,24-,25-,26-/m1/s1 |
| InChIKey | MOZBJBURGYBFDP-VKQKEIENSA-N |
| XLogP | 0.63 |
| TPSA | 195.24 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.53 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |