C23H17N2O10PS — CID 3083452
[2-[2-(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carbonyl)hydrazinyl]-2-oxoethyl]sulfanylphosphonic acid (PubChem CID 3083452) has the molecular formula C23H17N2O10PS and a molecular weight of 544.43 g/mol. Its IUPAC name is [2-[2-(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carbonyl)hydrazinyl]-2-oxoethyl]sulfanylphosphonic acid.
| Compound Name | [2-[2-(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carbonyl)hydrazinyl]-2-oxoethyl]sulfanylphosphonic acid |
|---|---|
| PubChem CID | 3083452 |
| Molecular Formula | C23H17N2O10PS |
| Molecular Weight | 544.43 g/mol |
| Exact Mass | 544.03 |
| IUPAC Name | [2-[2-(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carbonyl)hydrazinyl]-2-oxoethyl]sulfanylphosphonic acid |
| SMILES | O=C(CSP(=O)(O)O)NNC(=O)c1ccc2c(c1)C1(OC2=O)c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C23H17N2O10PS/c26-12-2-5-15-18(8-12)34-19-9-13(27)3-6-16(19)23(15)17-7-11(1-4-14(17)22(30)35-23)21(29)25-24-20(28)10-37-36(31,32)33/h1-9,26-27H,10H2,(H,24,28)(H,25,29)(H2,31,32,33) |
| InChIKey | AMSVFQUFOJVEHE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 191.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|