C33H38N2O8 — CID 169149903
tert-butyl N-[6-(methylamino)hexyl]carbamate;3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carbaldehyde (PubChem CID 169149903) has the molecular formula C33H38N2O8 and a molecular weight of 590.67 g/mol. Its IUPAC name is tert-butyl N-[6-(methylamino)hexyl]carbamate;3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carbaldehyde.
| Compound Name | tert-butyl N-[6-(methylamino)hexyl]carbamate;3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carbaldehyde |
|---|---|
| PubChem CID | 169149903 |
| Molecular Formula | C33H38N2O8 |
| Molecular Weight | 590.67 g/mol |
| Exact Mass | 590.26 |
| IUPAC Name | tert-butyl N-[6-(methylamino)hexyl]carbamate;3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carbaldehyde |
| SMILES | CNCCCCCCNC(=O)OC(C)(C)C.O=Cc1ccc2c(c1)C1(OC2=O)c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C21H12O6.C12H26N2O2/c22-10-11-1-4-14-17(7-11)21(27-20(14)25)15-5-2-12(23)8-18(15)26-19-9-13(24)3-6-16(19)21;1-12(2,3)16-11(15)14-10-8-6-5-7-9-13-4/h1-10,23-24H;13H,5-10H2,1-4H3,(H,14,15) |
| InChIKey | YDLVYKHZFONFDP-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 143.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.67 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|