C32H38N3O8S+ — CID 140741619
3-aminopropyl-[3-[(2',7'-dihydroxy-3-oxospiro[2-benzofuran-1,10'-9H-anthracene]-5-carbonyl)amino]propyl]-methyl-(3-sulfopropyl)azanium (PubChem CID 140741619) has the molecular formula C32H38N3O8S+ and a molecular weight of 624.74 g/mol. Its IUPAC name is 3-aminopropyl-[3-[(2',7'-dihydroxy-3-oxospiro[2-benzofuran-1,10'-9H-anthracene]-5-carbonyl)amino]propyl]-methyl-(3-sulfopropyl)azanium.
| Compound Name | 3-aminopropyl-[3-[(2',7'-dihydroxy-3-oxospiro[2-benzofuran-1,10'-9H-anthracene]-5-carbonyl)amino]propyl]-methyl-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 140741619 |
| Molecular Formula | C32H38N3O8S+ |
| Molecular Weight | 624.74 g/mol |
| Exact Mass | 624.24 |
| IUPAC Name | 3-aminopropyl-[3-[(2',7'-dihydroxy-3-oxospiro[2-benzofuran-1,10'-9H-anthracene]-5-carbonyl)amino]propyl]-methyl-(3-sulfopropyl)azanium |
| SMILES | C[N+](CCCN)(CCCNC(=O)c1ccc2c(c1)C(=O)OC21c2ccc(O)cc2Cc2cc(O)ccc21)CCCS(=O)(=O)O |
| InChI | InChI=1S/C32H37N3O8S/c1-35(13-2-11-33,15-4-16-44(40,41)42)14-3-12-34-30(38)21-5-8-29-26(20-21)31(39)43-32(29)27-9-6-24(36)18-22(27)17-23-19-25(37)7-10-28(23)32/h5-10,18-20H,2-4,11-17,33H2,1H3,(H3-,34,36,37,38,40,41,42)/p+1 |
| InChIKey | PFAKWMWZBIZOIW-UHFFFAOYSA-O |
| XLogP | 2.66 |
| TPSA | 176.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.74 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|