C35H35FN3O7P — CID 126730981
[4-[2-[[2',7'-bis(dimethylamino)-3-oxospiro[2-benzofuran-1,10'-9H-anthracene]-5-carbonyl]amino]ethyl]-2-(fluoromethyl)phenyl] dihydrogen phosphate (PubChem CID 126730981) has the molecular formula C35H35FN3O7P and a molecular weight of 659.65 g/mol. Its IUPAC name is [4-[2-[[2',7'-bis(dimethylamino)-3-oxospiro[2-benzofuran-1,10'-9H-anthracene]-5-carbonyl]amino]ethyl]-2-(fluoromethyl)phenyl] dihydrogen phosphate.
| Compound Name | [4-[2-[[2',7'-bis(dimethylamino)-3-oxospiro[2-benzofuran-1,10'-9H-anthracene]-5-carbonyl]amino]ethyl]-2-(fluoromethyl)phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 126730981 |
| Molecular Formula | C35H35FN3O7P |
| Molecular Weight | 659.65 g/mol |
| Exact Mass | 659.22 |
| IUPAC Name | [4-[2-[[2',7'-bis(dimethylamino)-3-oxospiro[2-benzofuran-1,10'-9H-anthracene]-5-carbonyl]amino]ethyl]-2-(fluoromethyl)phenyl] dihydrogen phosphate |
| SMILES | CN(C)c1ccc2c(c1)Cc1cc(N(C)C)ccc1C21OC(=O)c2cc(C(=O)NCCc3ccc(OP(=O)(O)O)c(CF)c3)ccc21 |
| InChI | InChI=1S/C35H35FN3O7P/c1-38(2)26-7-10-29-23(17-26)16-24-18-27(39(3)4)8-11-30(24)35(29)31-9-6-22(19-28(31)34(41)45-35)33(40)37-14-13-21-5-12-32(25(15-21)20-36)46-47(42,43)44/h5-12,15,17-19H,13-14,16,20H2,1-4H3,(H,37,40)(H2,42,43,44) |
| InChIKey | LPCWQUFBUWNNQE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 128.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.65 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|