C41H54N4O8 — CID 146240127
3',6'-bis(dimethylamino)-N-[2-[2-[3-(8-methoxyoctylamino)-3-oxopropoxy]ethoxy]ethyl]-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxamide (PubChem CID 146240127) has the molecular formula C41H54N4O8 and a molecular weight of 730.90 g/mol. Its IUPAC name is 3',6'-bis(dimethylamino)-N-[2-[2-[3-(8-methoxyoctylamino)-3-oxopropoxy]ethoxy]ethyl]-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxamide.
| Compound Name | 3',6'-bis(dimethylamino)-N-[2-[2-[3-(8-methoxyoctylamino)-3-oxopropoxy]ethoxy]ethyl]-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxamide |
|---|---|
| PubChem CID | 146240127 |
| Molecular Formula | C41H54N4O8 |
| Molecular Weight | 730.90 g/mol |
| Exact Mass | 730.39 |
| IUPAC Name | 3',6'-bis(dimethylamino)-N-[2-[2-[3-(8-methoxyoctylamino)-3-oxopropoxy]ethoxy]ethyl]-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxamide |
| SMILES | COCCCCCCCCNC(=O)CCOCCOCCNC(=O)c1ccc2c(c1)C1(OC2=O)c2ccc(N(C)C)cc2Oc2cc(N(C)C)ccc21 |
| InChI | InChI=1S/C41H54N4O8/c1-44(2)30-13-16-33-36(27-30)52-37-28-31(45(3)4)14-17-34(37)41(33)35-26-29(12-15-32(35)40(48)53-41)39(47)43-20-23-51-25-24-50-22-18-38(46)42-19-10-8-6-7-9-11-21-49-5/h12-17,26-28H,6-11,18-25H2,1-5H3,(H,42,46)(H,43,47) |
| InChIKey | NAXQMJXRJVZNQO-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 127.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.90 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|