C38H48ClN3O5 — CID 139208903
N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-2',7'-bis(dimethylamino)-9',9'-dimethyl-1-oxospiro[2-benzofuran-3,10'-anthracene]-5-carboxamide (PubChem CID 139208903) has the molecular formula C38H48ClN3O5 and a molecular weight of 662.27 g/mol. Its IUPAC name is N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-2',7'-bis(dimethylamino)-9',9'-dimethyl-1-oxospiro[2-benzofuran-3,10'-anthracene]-5-carboxamide.
| Compound Name | N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-2',7'-bis(dimethylamino)-9',9'-dimethyl-1-oxospiro[2-benzofuran-3,10'-anthracene]-5-carboxamide |
|---|---|
| PubChem CID | 139208903 |
| Molecular Formula | C38H48ClN3O5 |
| Molecular Weight | 662.27 g/mol |
| Exact Mass | 661.33 |
| IUPAC Name | N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-2',7'-bis(dimethylamino)-9',9'-dimethyl-1-oxospiro[2-benzofuran-3,10'-anthracene]-5-carboxamide |
| SMILES | CN(C)c1ccc2c(c1)C(C)(C)c1cc(N(C)C)ccc1C21OC(=O)c2ccc(C(=O)NCCOCCOCCCCCCCl)cc21 |
| InChI | InChI=1S/C38H48ClN3O5/c1-37(2)33-24-27(41(3)4)12-15-30(33)38(31-16-13-28(42(5)6)25-34(31)37)32-23-26(11-14-29(32)36(44)47-38)35(43)40-18-20-46-22-21-45-19-10-8-7-9-17-39/h11-16,23-25H,7-10,17-22H2,1-6H3,(H,40,43) |
| InChIKey | SRCUKBJUHGRPTA-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.27 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|