C43H48ClN5O7 — CID 146671831
N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-2'-cyano-2-[7-(diethylamino)-2-oxochromen-3-yl]-7-(dimethylamino)-1'-oxospiro[chromene-4,3'-isoindole]-5'-carboxamide (PubChem CID 146671831) has the molecular formula C43H48ClN5O7 and a molecular weight of 782.34 g/mol. Its IUPAC name is N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-2'-cyano-2-[7-(diethylamino)-2-oxochromen-3-yl]-7-(dimethylamino)-1'-oxospiro[chromene-4,3'-isoindole]-5'-carboxamide.
| Compound Name | N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-2'-cyano-2-[7-(diethylamino)-2-oxochromen-3-yl]-7-(dimethylamino)-1'-oxospiro[chromene-4,3'-isoindole]-5'-carboxamide |
|---|---|
| PubChem CID | 146671831 |
| Molecular Formula | C43H48ClN5O7 |
| Molecular Weight | 782.34 g/mol |
| Exact Mass | 781.32 |
| IUPAC Name | N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-2'-cyano-2-[7-(diethylamino)-2-oxochromen-3-yl]-7-(dimethylamino)-1'-oxospiro[chromene-4,3'-isoindole]-5'-carboxamide |
| SMILES | CCN(CC)c1ccc2cc(C3=CC4(c5ccc(N(C)C)cc5O3)c3cc(C(=O)NCCOCCOCCCCCCCl)ccc3C(=O)N4C#N)c(=O)oc2c1 |
| InChI | InChI=1S/C43H48ClN5O7/c1-5-48(6-2)32-13-11-29-23-34(42(52)56-37(29)26-32)39-27-43(35-16-14-31(47(3)4)25-38(35)55-39)36-24-30(12-15-33(36)41(51)49(43)28-45)40(50)46-18-20-54-22-21-53-19-10-8-7-9-17-44/h11-16,23-27H,5-10,17-22H2,1-4H3,(H,46,50) |
| InChIKey | OVGXTGGYSYFPLN-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 137.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.34 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|