C40H51ClN4O7 — CID 167447868
3',6'-bis(azetidin-1-yl)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-2-imino-1-oxospiro[indene-3,9'-xanthene]-5-carboxamide;methanol (PubChem CID 167447868) has the molecular formula C40H51ClN4O7 and a molecular weight of 735.32 g/mol. Its IUPAC name is 3',6'-bis(azetidin-1-yl)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-2-imino-1-oxospiro[indene-3,9'-xanthene]-5-carboxamide;methanol.
| Compound Name | 3',6'-bis(azetidin-1-yl)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-2-imino-1-oxospiro[indene-3,9'-xanthene]-5-carboxamide;methanol |
|---|---|
| PubChem CID | 167447868 |
| Molecular Formula | C40H51ClN4O7 |
| Molecular Weight | 735.32 g/mol |
| Exact Mass | 734.34 |
| IUPAC Name | 3',6'-bis(azetidin-1-yl)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-2-imino-1-oxospiro[indene-3,9'-xanthene]-5-carboxamide;methanol |
| SMILES | CO.CO.[H]/N=C1\C(=O)c2ccc(C(=O)NCCOCCOCCCCCCCl)cc2C12c1ccc(N3CCC3)cc1Oc1cc(N3CCC3)ccc12 |
| InChI | InChI=1S/C38H43ClN4O5.2CH4O/c39-13-3-1-2-4-19-46-21-22-47-20-14-41-37(45)26-7-10-29-32(23-26)38(36(40)35(29)44)30-11-8-27(42-15-5-16-42)24-33(30)48-34-25-28(9-12-31(34)38)43-17-6-18-43;2*1-2/h7-12,23-25,40H,1-6,13-22H2,(H,41,45);2*2H,1H3/b40-36+;; |
| InChIKey | MWMOZPHZRYPBIH-WELNRVKZSA-N |
| XLogP | 5.54 |
| TPSA | 144.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.32 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|