C37H42ClN5O4 — CID 167427739
3',6'-bis(azetidin-1-yl)-5-[2-[2-(6-chlorohexoxy)ethoxy]ethylamino]-2-diazospiro[indene-3,9'-xanthene]-1-one (PubChem CID 167427739) has the molecular formula C37H42ClN5O4 and a molecular weight of 656.23 g/mol. Its IUPAC name is 3',6'-bis(azetidin-1-yl)-5-[2-[2-(6-chlorohexoxy)ethoxy]ethylamino]-2-diazospiro[indene-3,9'-xanthene]-1-one.
| Compound Name | 3',6'-bis(azetidin-1-yl)-5-[2-[2-(6-chlorohexoxy)ethoxy]ethylamino]-2-diazospiro[indene-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 167427739 |
| Molecular Formula | C37H42ClN5O4 |
| Molecular Weight | 656.23 g/mol |
| Exact Mass | 655.29 |
| IUPAC Name | 3',6'-bis(azetidin-1-yl)-5-[2-[2-(6-chlorohexoxy)ethoxy]ethylamino]-2-diazospiro[indene-3,9'-xanthene]-1-one |
| SMILES | [N-]=[N+]=C1C(=O)c2ccc(NCCOCCOCCCCCCCl)cc2C12c1ccc(N3CCC3)cc1Oc1cc(N3CCC3)ccc12 |
| InChI | InChI=1S/C37H42ClN5O4/c38-13-3-1-2-4-19-45-21-22-46-20-14-40-26-7-10-29-32(23-26)37(36(41-39)35(29)44)30-11-8-27(42-15-5-16-42)24-33(30)47-34-25-28(9-12-31(34)37)43-17-6-18-43/h7-12,23-25,40H,1-6,13-22H2 |
| InChIKey | KRCLSKPYDJUDHY-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 99.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.23 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|