C37H42ClN3O6 — CID 167427786
N-[3',6'-bis(azetidin-1-yl)-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl]-3-[2-(6-chlorohexoxy)ethoxy]propanamide (PubChem CID 167427786) has the molecular formula C37H42ClN3O6 and a molecular weight of 660.21 g/mol. Its IUPAC name is N-[3',6'-bis(azetidin-1-yl)-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl]-3-[2-(6-chlorohexoxy)ethoxy]propanamide.
| Compound Name | N-[3',6'-bis(azetidin-1-yl)-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl]-3-[2-(6-chlorohexoxy)ethoxy]propanamide |
|---|---|
| PubChem CID | 167427786 |
| Molecular Formula | C37H42ClN3O6 |
| Molecular Weight | 660.21 g/mol |
| Exact Mass | 659.28 |
| IUPAC Name | N-[3',6'-bis(azetidin-1-yl)-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl]-3-[2-(6-chlorohexoxy)ethoxy]propanamide |
| SMILES | O=C(CCOCCOCCCCCCCl)Nc1ccc2c(c1)C1(OC2=O)c2ccc(N3CCC3)cc2Oc2cc(N3CCC3)ccc21 |
| InChI | InChI=1S/C37H42ClN3O6/c38-14-3-1-2-4-19-44-21-22-45-20-13-35(42)39-26-7-10-29-32(23-26)37(47-36(29)43)30-11-8-27(40-15-5-16-40)24-33(30)46-34-25-28(9-12-31(34)37)41-17-6-18-41/h7-12,23-25H,1-6,13-22H2,(H,39,42) |
| InChIKey | QCKOWLNDKKRLFM-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 89.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.21 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|