C28H26N2O9S — CID 163297019
2-[2-[(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl)carbamothioylamino]ethoxy]ethyl 2-hydroxypropanoate (PubChem CID 163297019) has the molecular formula C28H26N2O9S and a molecular weight of 566.59 g/mol. Its IUPAC name is 2-[2-[(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl)carbamothioylamino]ethoxy]ethyl 2-hydroxypropanoate.
| Compound Name | 2-[2-[(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl)carbamothioylamino]ethoxy]ethyl 2-hydroxypropanoate |
|---|---|
| PubChem CID | 163297019 |
| Molecular Formula | C28H26N2O9S |
| Molecular Weight | 566.59 g/mol |
| Exact Mass | 566.14 |
| IUPAC Name | 2-[2-[(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl)carbamothioylamino]ethoxy]ethyl 2-hydroxypropanoate |
| SMILES | CC(O)C(=O)OCCOCCNC(=S)Nc1ccc2c(c1)C1(OC2=O)c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C28H26N2O9S/c1-15(31)25(34)37-11-10-36-9-8-29-27(40)30-16-2-5-19-22(12-16)28(39-26(19)35)20-6-3-17(32)13-23(20)38-24-14-18(33)4-7-21(24)28/h2-7,12-15,31-33H,8-11H2,1H3,(H2,29,30,40) |
| InChIKey | RVDIHZPIGCEQKP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 155.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.59 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|