C33H35N5O10 — CID 58352513
N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-N'-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)pentanediamide (PubChem CID 58352513) has the molecular formula C33H35N5O10 and a molecular weight of 661.67 g/mol. Its IUPAC name is N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-N'-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)pentanediamide.
| Compound Name | N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-N'-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)pentanediamide |
|---|---|
| PubChem CID | 58352513 |
| Molecular Formula | C33H35N5O10 |
| Molecular Weight | 661.67 g/mol |
| Exact Mass | 661.24 |
| IUPAC Name | N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-N'-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)pentanediamide |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCNC(=O)CCCC(=O)Nc1ccc2c(c1)C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C33H35N5O10/c34-38-36-11-13-45-15-17-46-16-14-44-12-10-35-30(41)2-1-3-31(42)37-21-4-7-25-24(18-21)32(43)48-33(25)26-8-5-22(39)19-28(26)47-29-20-23(40)6-9-27(29)33/h4-9,18-20,39-40H,1-3,10-17H2,(H,35,41)(H,37,42) |
| InChIKey | VWSBYQBFHORTLY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 210.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.67 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|