C40H32N4O10 — CID 91528794
2-cyano-N-[4-[4-[[2-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)amino]-2-oxoethyl]amino]-4-oxobutoxy]phenyl]-3-oxohept-6-ynamide (PubChem CID 91528794) has the molecular formula C40H32N4O10 and a molecular weight of 728.71 g/mol. Its IUPAC name is 2-cyano-N-[4-[4-[[2-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)amino]-2-oxoethyl]amino]-4-oxobutoxy]phenyl]-3-oxohept-6-ynamide.
| Compound Name | 2-cyano-N-[4-[4-[[2-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)amino]-2-oxoethyl]amino]-4-oxobutoxy]phenyl]-3-oxohept-6-ynamide |
|---|---|
| PubChem CID | 91528794 |
| Molecular Formula | C40H32N4O10 |
| Molecular Weight | 728.71 g/mol |
| Exact Mass | 728.21 |
| IUPAC Name | 2-cyano-N-[4-[4-[[2-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)amino]-2-oxoethyl]amino]-4-oxobutoxy]phenyl]-3-oxohept-6-ynamide |
| SMILES | C#CCCC(=O)C(C#N)C(=O)Nc1ccc(OCCCC(=O)NCC(=O)Nc2ccc3c(c2)C(=O)OC32c3ccc(O)cc3Oc3cc(O)ccc32)cc1 |
| InChI | InChI=1S/C40H32N4O10/c1-2-3-5-33(47)29(21-41)38(50)44-23-7-12-27(13-8-23)52-17-4-6-36(48)42-22-37(49)43-24-9-14-30-28(18-24)39(51)54-40(30)31-15-10-25(45)19-34(31)53-35-20-26(46)11-16-32(35)40/h1,7-16,18-20,29,45-46H,3-6,17,22H2,(H,42,48)(H,43,49)(H,44,50) |
| InChIKey | ILJQXBMRUWEXGG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 213.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.71 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|