C47H46N4O10 — CID 91253214
N-[6-[6-[4-[(2-cyano-3-oxohept-6-ynoyl)amino]phenoxy]hexanoylamino]hexyl]-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxamide (PubChem CID 91253214) has the molecular formula C47H46N4O10 and a molecular weight of 826.90 g/mol. Its IUPAC name is N-[6-[6-[4-[(2-cyano-3-oxohept-6-ynoyl)amino]phenoxy]hexanoylamino]hexyl]-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxamide.
| Compound Name | N-[6-[6-[4-[(2-cyano-3-oxohept-6-ynoyl)amino]phenoxy]hexanoylamino]hexyl]-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxamide |
|---|---|
| PubChem CID | 91253214 |
| Molecular Formula | C47H46N4O10 |
| Molecular Weight | 826.90 g/mol |
| Exact Mass | 826.32 |
| IUPAC Name | N-[6-[6-[4-[(2-cyano-3-oxohept-6-ynoyl)amino]phenoxy]hexanoylamino]hexyl]-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxamide |
| SMILES | C#CCCC(=O)C(C#N)C(=O)Nc1ccc(OCCCCCC(=O)NCCCCCCNC(=O)c2ccc3c(c2)C2(OC3=O)c3ccc(O)cc3Oc3cc(O)ccc32)cc1 |
| InChI | InChI=1S/C47H46N4O10/c1-2-3-11-40(54)36(29-48)45(57)51-31-14-18-34(19-15-31)59-25-10-6-7-12-43(55)49-23-8-4-5-9-24-50-44(56)30-13-20-35-39(26-30)47(61-46(35)58)37-21-16-32(52)27-41(37)60-42-28-33(53)17-22-38(42)47/h1,13-22,26-28,36,52-53H,3-12,23-25H2,(H,49,55)(H,50,56)(H,51,57) |
| InChIKey | MEPOFBLFGVQBFR-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 213.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.90 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|