C29H23N3O10S — CID 167312843
(2,5-dioxopyrrolidin-1-yl) 2-[2-[(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl)carbamothioylamino]ethoxy]acetate (PubChem CID 167312843) has the molecular formula C29H23N3O10S and a molecular weight of 605.58 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[2-[(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl)carbamothioylamino]ethoxy]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-[(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl)carbamothioylamino]ethoxy]acetate |
|---|---|
| PubChem CID | 167312843 |
| Molecular Formula | C29H23N3O10S |
| Molecular Weight | 605.58 g/mol |
| Exact Mass | 605.11 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-[(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl)carbamothioylamino]ethoxy]acetate |
| SMILES | O=C(COCCNC(=S)Nc1ccc2c(c1)C1(OC2=O)c2ccc(O)cc2Oc2cc(O)ccc21)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C29H23N3O10S/c33-16-2-5-19-22(12-16)40-23-13-17(34)3-6-20(23)29(19)21-11-15(1-4-18(21)27(38)41-29)31-28(43)30-9-10-39-14-26(37)42-32-24(35)7-8-25(32)36/h1-6,11-13,33-34H,7-10,14H2,(H2,30,31,43) |
| InChIKey | JUIKIQRXRRVORC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 172.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.58 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|