C36H31N5O8S — CID 162407740
N-[2-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamothioylamino]ethyl]-4-[5-(2-hydroxyethoxy)-4,5-dihydropyridazin-3-yl]benzamide (PubChem CID 162407740) has the molecular formula C36H31N5O8S and a molecular weight of 693.74 g/mol. Its IUPAC name is N-[2-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamothioylamino]ethyl]-4-[5-(2-hydroxyethoxy)-4,5-dihydropyridazin-3-yl]benzamide.
| Compound Name | N-[2-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamothioylamino]ethyl]-4-[5-(2-hydroxyethoxy)-4,5-dihydropyridazin-3-yl]benzamide |
|---|---|
| PubChem CID | 162407740 |
| Molecular Formula | C36H31N5O8S |
| Molecular Weight | 693.74 g/mol |
| Exact Mass | 693.19 |
| IUPAC Name | N-[2-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamothioylamino]ethyl]-4-[5-(2-hydroxyethoxy)-4,5-dihydropyridazin-3-yl]benzamide |
| SMILES | O=C(NCCNC(=S)Nc1ccc2c(c1)C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21)c1ccc(C2=NN=CC(OCCO)C2)cc1 |
| InChI | InChI=1S/C36H31N5O8S/c42-13-14-47-25-18-30(41-39-19-25)20-1-3-21(4-2-20)33(45)37-11-12-38-35(50)40-22-5-8-27-26(15-22)34(46)49-36(27)28-9-6-23(43)16-31(28)48-32-17-24(44)7-10-29(32)36/h1-10,15-17,19,25,42-44H,11-14,18H2,(H,37,45)(H2,38,40,50) |
| InChIKey | MQJNTCZUMCZRCX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 183.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.74 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|