C48H56ClN7O9 — CID 167427797
N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-2-diazo-3',6'-bis[3-(morpholine-4-carbonyl)azetidin-1-yl]-1-oxospiro[indene-3,9'-xanthene]-5-carboxamide (PubChem CID 167427797) has the molecular formula C48H56ClN7O9 and a molecular weight of 910.47 g/mol. Its IUPAC name is N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-2-diazo-3',6'-bis[3-(morpholine-4-carbonyl)azetidin-1-yl]-1-oxospiro[indene-3,9'-xanthene]-5-carboxamide.
| Compound Name | N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-2-diazo-3',6'-bis[3-(morpholine-4-carbonyl)azetidin-1-yl]-1-oxospiro[indene-3,9'-xanthene]-5-carboxamide |
|---|---|
| PubChem CID | 167427797 |
| Molecular Formula | C48H56ClN7O9 |
| Molecular Weight | 910.47 g/mol |
| Exact Mass | 909.38 |
| IUPAC Name | N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-2-diazo-3',6'-bis[3-(morpholine-4-carbonyl)azetidin-1-yl]-1-oxospiro[indene-3,9'-xanthene]-5-carboxamide |
| SMILES | [N-]=[N+]=C1C(=O)c2ccc(C(=O)NCCOCCOCCCCCCCl)cc2C12c1ccc(N3CC(C(=O)N4CCOCC4)C3)cc1Oc1cc(N3CC(C(=O)N4CCOCC4)C3)ccc12 |
| InChI | InChI=1S/C48H56ClN7O9/c49-11-3-1-2-4-17-61-23-24-62-18-12-51-45(58)32-5-8-37-40(25-32)48(44(52-50)43(37)57)38-9-6-35(55-28-33(29-55)46(59)53-13-19-63-20-14-53)26-41(38)65-42-27-36(7-10-39(42)48)56-30-34(31-56)47(60)54-15-21-64-22-16-54/h5-10,25-27,33-34H,1-4,11-24,28-31H2,(H,51,58) |
| InChIKey | HNWCUTHHSRSCJW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 175.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|