C41H56ClN5O7S — CID 146671491
N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-3',6'-bis(diethylamino)-2-(dimethylsulfamoyl)-1-oxospiro[isoindole-3,9'-xanthene]-5-carboxamide (PubChem CID 146671491) has the molecular formula C41H56ClN5O7S and a molecular weight of 798.45 g/mol. Its IUPAC name is N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-3',6'-bis(diethylamino)-2-(dimethylsulfamoyl)-1-oxospiro[isoindole-3,9'-xanthene]-5-carboxamide.
| Compound Name | N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-3',6'-bis(diethylamino)-2-(dimethylsulfamoyl)-1-oxospiro[isoindole-3,9'-xanthene]-5-carboxamide |
|---|---|
| PubChem CID | 146671491 |
| Molecular Formula | C41H56ClN5O7S |
| Molecular Weight | 798.45 g/mol |
| Exact Mass | 797.36 |
| IUPAC Name | N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-3',6'-bis(diethylamino)-2-(dimethylsulfamoyl)-1-oxospiro[isoindole-3,9'-xanthene]-5-carboxamide |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C21c2cc(C(=O)NCCOCCOCCCCCCCl)ccc2C(=O)N1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C41H56ClN5O7S/c1-7-45(8-2)31-16-19-34-37(28-31)54-38-29-32(46(9-3)10-4)17-20-35(38)41(34)36-27-30(15-18-33(36)40(49)47(41)55(50,51)44(5)6)39(48)43-22-24-53-26-25-52-23-14-12-11-13-21-42/h15-20,27-29H,7-14,21-26H2,1-6H3,(H,43,48) |
| InChIKey | CRIHGZYCBYZLOF-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 120.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.45 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|