C30H36N4O4S — CID 146670380
3',6'-bis(diethylamino)-N,N-dimethyl-3-oxospiro[isoindole-1,9'-xanthene]-2-sulfonamide (PubChem CID 146670380) has the molecular formula C30H36N4O4S and a molecular weight of 548.71 g/mol. Its IUPAC name is 3',6'-bis(diethylamino)-N,N-dimethyl-3-oxospiro[isoindole-1,9'-xanthene]-2-sulfonamide.
| Compound Name | 3',6'-bis(diethylamino)-N,N-dimethyl-3-oxospiro[isoindole-1,9'-xanthene]-2-sulfonamide |
|---|---|
| PubChem CID | 146670380 |
| Molecular Formula | C30H36N4O4S |
| Molecular Weight | 548.71 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | 3',6'-bis(diethylamino)-N,N-dimethyl-3-oxospiro[isoindole-1,9'-xanthene]-2-sulfonamide |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C21c2ccccc2C(=O)N1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C30H36N4O4S/c1-7-32(8-2)21-15-17-25-27(19-21)38-28-20-22(33(9-3)10-4)16-18-26(28)30(25)24-14-12-11-13-23(24)29(35)34(30)39(36,37)31(5)6/h11-20H,7-10H2,1-6H3 |
| InChIKey | NLENOSOYMGHFBG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.71 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|