C36H40N4O2 — CID 102193560
2-[2-[bis(prop-2-ynyl)amino]ethyl]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one (PubChem CID 102193560) has the molecular formula C36H40N4O2 and a molecular weight of 560.74 g/mol. Its IUPAC name is 2-[2-[bis(prop-2-ynyl)amino]ethyl]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one.
| Compound Name | 2-[2-[bis(prop-2-ynyl)amino]ethyl]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 102193560 |
| Molecular Formula | C36H40N4O2 |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.32 |
| IUPAC Name | 2-[2-[bis(prop-2-ynyl)amino]ethyl]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one |
| SMILES | C#CCN(CC#C)CCN1C(=O)c2ccccc2C12c1ccc(N(CC)CC)cc1Oc1cc(N(CC)CC)ccc12 |
| InChI | InChI=1S/C36H40N4O2/c1-7-21-37(22-8-2)23-24-40-35(41)29-15-13-14-16-30(29)36(40)31-19-17-27(38(9-3)10-4)25-33(31)42-34-26-28(18-20-32(34)36)39(11-5)12-6/h1-2,13-20,25-26H,9-12,21-24H2,3-6H3 |
| InChIKey | PCIHQWADEJRFPP-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 39.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|