C38H52N6O2 — CID 71813135
2-[3-[4-(3-aminopropyl)piperazin-1-yl]propyl]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one (PubChem CID 71813135) has the molecular formula C38H52N6O2 and a molecular weight of 624.87 g/mol. Its IUPAC name is 2-[3-[4-(3-aminopropyl)piperazin-1-yl]propyl]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one.
| Compound Name | 2-[3-[4-(3-aminopropyl)piperazin-1-yl]propyl]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 71813135 |
| Molecular Formula | C38H52N6O2 |
| Molecular Weight | 624.87 g/mol |
| Exact Mass | 624.42 |
| IUPAC Name | 2-[3-[4-(3-aminopropyl)piperazin-1-yl]propyl]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C21c2ccccc2C(=O)N1CCCN1CCN(CCCN)CC1 |
| InChI | InChI=1S/C38H52N6O2/c1-5-42(6-2)29-15-17-33-35(27-29)46-36-28-30(43(7-3)8-4)16-18-34(36)38(33)32-14-10-9-13-31(32)37(45)44(38)22-12-21-41-25-23-40(24-26-41)20-11-19-39/h9-10,13-18,27-28H,5-8,11-12,19-26,39H2,1-4H3 |
| InChIKey | UIPAKQVIMGVBLY-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.87 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|