C34H44N4O2 — CID 139052947
2-butyl-3',6'-bis(diethylamino)-7-(dimethylamino)spiro[isoindole-3,9'-xanthene]-1-one (PubChem CID 139052947) has the molecular formula C34H44N4O2 and a molecular weight of 540.75 g/mol. Its IUPAC name is 2-butyl-3',6'-bis(diethylamino)-7-(dimethylamino)spiro[isoindole-3,9'-xanthene]-1-one.
| Compound Name | 2-butyl-3',6'-bis(diethylamino)-7-(dimethylamino)spiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 139052947 |
| Molecular Formula | C34H44N4O2 |
| Molecular Weight | 540.75 g/mol |
| Exact Mass | 540.35 |
| IUPAC Name | 2-butyl-3',6'-bis(diethylamino)-7-(dimethylamino)spiro[isoindole-3,9'-xanthene]-1-one |
| SMILES | CCCCN1C(=O)c2c(N(C)C)cccc2C12c1ccc(N(CC)CC)cc1Oc1cc(N(CC)CC)ccc12 |
| InChI | InChI=1S/C34H44N4O2/c1-8-13-21-38-33(39)32-28(15-14-16-29(32)35(6)7)34(38)26-19-17-24(36(9-2)10-3)22-30(26)40-31-23-25(18-20-27(31)34)37(11-4)12-5/h14-20,22-23H,8-13,21H2,1-7H3 |
| InChIKey | VXWUZLTXWPTJSB-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 39.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.75 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|