C29H34N4O2S — CID 146670379
3',6'-bis(diethylamino)-1'-(methylamino)-2-sulfanylspiro[isoindole-3,9'-xanthene]-1-one (PubChem CID 146670379) has the molecular formula C29H34N4O2S and a molecular weight of 502.68 g/mol. Its IUPAC name is 3',6'-bis(diethylamino)-1'-(methylamino)-2-sulfanylspiro[isoindole-3,9'-xanthene]-1-one.
| Compound Name | 3',6'-bis(diethylamino)-1'-(methylamino)-2-sulfanylspiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 146670379 |
| Molecular Formula | C29H34N4O2S |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | 3',6'-bis(diethylamino)-1'-(methylamino)-2-sulfanylspiro[isoindole-3,9'-xanthene]-1-one |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)cc(NC)c1C21c2ccccc2C(=O)N1S |
| InChI | InChI=1S/C29H34N4O2S/c1-6-31(7-2)19-14-15-23-25(17-19)35-26-18-20(32(8-3)9-4)16-24(30-5)27(26)29(23)22-13-11-10-12-21(22)28(34)33(29)36/h10-18,30,36H,6-9H2,1-5H3 |
| InChIKey | JMNYFNMJHVQHIN-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|