C32H40N4O2S2 — CID 147723557
2-[2-(2-aminoethyldisulfanyl)ethyl]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one (PubChem CID 147723557) has the molecular formula C32H40N4O2S2 and a molecular weight of 576.83 g/mol. Its IUPAC name is 2-[2-(2-aminoethyldisulfanyl)ethyl]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one.
| Compound Name | 2-[2-(2-aminoethyldisulfanyl)ethyl]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 147723557 |
| Molecular Formula | C32H40N4O2S2 |
| Molecular Weight | 576.83 g/mol |
| Exact Mass | 576.26 |
| IUPAC Name | 2-[2-(2-aminoethyldisulfanyl)ethyl]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C21c2ccccc2C(=O)N1CCSSCCN |
| InChI | InChI=1S/C32H40N4O2S2/c1-5-34(6-2)23-13-15-27-29(21-23)38-30-22-24(35(7-3)8-4)14-16-28(30)32(27)26-12-10-9-11-25(26)31(37)36(32)18-20-40-39-19-17-33/h9-16,21-22H,5-8,17-20,33H2,1-4H3 |
| InChIKey | GXARZKYVBDODEW-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.83 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|