C48H51N5O4 — CID 162370927
2-[3-[3',6'-bis(diethylamino)-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]propyl]-6-piperidin-1-ylbenzo[de]isoquinoline-1,3-dione (PubChem CID 162370927) has the molecular formula C48H51N5O4 and a molecular weight of 761.97 g/mol. Its IUPAC name is 2-[3-[3',6'-bis(diethylamino)-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]propyl]-6-piperidin-1-ylbenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[3-[3',6'-bis(diethylamino)-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]propyl]-6-piperidin-1-ylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 162370927 |
| Molecular Formula | C48H51N5O4 |
| Molecular Weight | 761.97 g/mol |
| Exact Mass | 761.39 |
| IUPAC Name | 2-[3-[3',6'-bis(diethylamino)-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]propyl]-6-piperidin-1-ylbenzo[de]isoquinoline-1,3-dione |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C21c2ccccc2C(=O)N1CCCN1C(=O)c2cccc3c(N4CCCCC4)ccc(c23)C1=O |
| InChI | InChI=1S/C48H51N5O4/c1-5-49(6-2)32-20-23-39-42(30-32)57-43-31-33(50(7-3)8-4)21-24-40(43)48(39)38-19-11-10-16-34(38)47(56)53(48)29-15-28-52-45(54)36-18-14-17-35-41(51-26-12-9-13-27-51)25-22-37(44(35)36)46(52)55/h10-11,14,16-25,30-31H,5-9,12-13,15,26-29H2,1-4H3 |
| InChIKey | LBNMINNRAXVIFS-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 76.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.97 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|