C51H49N5O6 — CID 177439306
6-[4-[(E)-[3',6'-bis(diethylamino)-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]iminomethyl]-3-hydroxyphenoxy]-2-butylbenzo[de]isoquinoline-1,3-dione (PubChem CID 177439306) has the molecular formula C51H49N5O6 and a molecular weight of 827.98 g/mol. Its IUPAC name is 6-[4-[(E)-[3',6'-bis(diethylamino)-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]iminomethyl]-3-hydroxyphenoxy]-2-butylbenzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-[4-[(E)-[3',6'-bis(diethylamino)-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]iminomethyl]-3-hydroxyphenoxy]-2-butylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 177439306 |
| Molecular Formula | C51H49N5O6 |
| Molecular Weight | 827.98 g/mol |
| Exact Mass | 827.37 |
| IUPAC Name | 6-[4-[(E)-[3',6'-bis(diethylamino)-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]iminomethyl]-3-hydroxyphenoxy]-2-butylbenzo[de]isoquinoline-1,3-dione |
| SMILES | CCCCN1C(=O)c2cccc3c(Oc4ccc(/C=N/N5C(=O)c6ccccc6C56c5ccc(N(CC)CC)cc5Oc5cc(N(CC)CC)ccc56)c(O)c4)ccc(c23)C1=O |
| InChI | InChI=1S/C51H49N5O6/c1-6-11-27-55-48(58)38-17-14-16-37-44(26-23-39(47(37)38)49(55)59)61-35-22-19-32(43(57)30-35)31-52-56-50(60)36-15-12-13-18-40(36)51(56)41-24-20-33(53(7-2)8-3)28-45(41)62-46-29-34(21-25-42(46)51)54(9-4)10-5/h12-26,28-31,57H,6-11,27H2,1-5H3/b52-31+ |
| InChIKey | UUDHDOROOIHRPQ-VLIFSHEFSA-N |
| XLogP | 10.31 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.98 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|