C33H30N4O3 — CID 136503971
3'-(diethylamino)-2-[(E)-2-(2-hydroxyphenyl)iminoethylideneamino]-6'-methylspiro[isoindole-3,9'-xanthene]-1-one (PubChem CID 136503971) has the molecular formula C33H30N4O3 and a molecular weight of 530.63 g/mol. Its IUPAC name is 3'-(diethylamino)-2-[(E)-2-(2-hydroxyphenyl)iminoethylideneamino]-6'-methylspiro[isoindole-3,9'-xanthene]-1-one.
| Compound Name | 3'-(diethylamino)-2-[(E)-2-(2-hydroxyphenyl)iminoethylideneamino]-6'-methylspiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 136503971 |
| Molecular Formula | C33H30N4O3 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | 3'-(diethylamino)-2-[(E)-2-(2-hydroxyphenyl)iminoethylideneamino]-6'-methylspiro[isoindole-3,9'-xanthene]-1-one |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(C)ccc1C21c2ccccc2C(=O)N1/N=C/C=N/c1ccccc1O |
| InChI | InChI=1S/C33H30N4O3/c1-4-36(5-2)23-15-17-27-31(21-23)40-30-20-22(3)14-16-26(30)33(27)25-11-7-6-10-24(25)32(39)37(33)35-19-18-34-28-12-8-9-13-29(28)38/h6-21,38H,4-5H2,1-3H3/b34-18+,35-19+ |
| InChIKey | LNKQWGIVKRGGOR-WKCPDWHCSA-N |
| XLogP | 6.79 |
| TPSA | 77.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|