C38H40N4O3 — CID 177479558
3',6'-bis(diethylamino)-2-[(E)-[(E)-3-(2-methoxyphenyl)prop-2-enylidene]amino]spiro[isoindole-3,9'-xanthene]-1-one (PubChem CID 177479558) has the molecular formula C38H40N4O3 and a molecular weight of 600.76 g/mol. Its IUPAC name is 3',6'-bis(diethylamino)-2-[(E)-[(E)-3-(2-methoxyphenyl)prop-2-enylidene]amino]spiro[isoindole-3,9'-xanthene]-1-one.
| Compound Name | 3',6'-bis(diethylamino)-2-[(E)-[(E)-3-(2-methoxyphenyl)prop-2-enylidene]amino]spiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 177479558 |
| Molecular Formula | C38H40N4O3 |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.31 |
| IUPAC Name | 3',6'-bis(diethylamino)-2-[(E)-[(E)-3-(2-methoxyphenyl)prop-2-enylidene]amino]spiro[isoindole-3,9'-xanthene]-1-one |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C21c2ccccc2C(=O)N1/N=C/C=C/c1ccccc1OC |
| InChI | InChI=1S/C38H40N4O3/c1-6-40(7-2)28-20-22-32-35(25-28)45-36-26-29(41(8-3)9-4)21-23-33(36)38(32)31-18-12-11-17-30(31)37(43)42(38)39-24-14-16-27-15-10-13-19-34(27)44-5/h10-26H,6-9H2,1-5H3/b16-14+,39-24+ |
| InChIKey | PXSVVAANPBUCPK-MFLIPFELSA-N |
| XLogP | 7.94 |
| TPSA | 57.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|