C39H45N5O3 — CID 177476905
3',6'-bis(diethylamino)-2-[(E)-[5-(diethylamino)-2-hydroxyphenyl]methylideneamino]spiro[isoindole-3,9'-xanthene]-1-one (PubChem CID 177476905) has the molecular formula C39H45N5O3 and a molecular weight of 631.82 g/mol. Its IUPAC name is 3',6'-bis(diethylamino)-2-[(E)-[5-(diethylamino)-2-hydroxyphenyl]methylideneamino]spiro[isoindole-3,9'-xanthene]-1-one.
| Compound Name | 3',6'-bis(diethylamino)-2-[(E)-[5-(diethylamino)-2-hydroxyphenyl]methylideneamino]spiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 177476905 |
| Molecular Formula | C39H45N5O3 |
| Molecular Weight | 631.82 g/mol |
| Exact Mass | 631.35 |
| IUPAC Name | 3',6'-bis(diethylamino)-2-[(E)-[5-(diethylamino)-2-hydroxyphenyl]methylideneamino]spiro[isoindole-3,9'-xanthene]-1-one |
| SMILES | CCN(CC)c1ccc(O)c(/C=N/N2C(=O)c3ccccc3C23c2ccc(N(CC)CC)cc2Oc2cc(N(CC)CC)ccc23)c1 |
| InChI | InChI=1S/C39H45N5O3/c1-7-41(8-2)28-19-22-35(45)27(23-28)26-40-44-38(46)31-15-13-14-16-32(31)39(44)33-20-17-29(42(9-3)10-4)24-36(33)47-37-25-30(18-21-34(37)39)43(11-5)12-6/h13-26,45H,7-12H2,1-6H3/b40-26+ |
| InChIKey | CPSHREWNNGFKOY-IHELAITMSA-N |
| XLogP | 7.82 |
| TPSA | 71.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.82 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|