C39H40N6O2 — CID 178180590
(E)-3-[4-[[3',6'-bis(diethylamino)-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]iminomethyl]-N-methylanilino]prop-2-enenitrile (PubChem CID 178180590) has the molecular formula C39H40N6O2 and a molecular weight of 624.79 g/mol. Its IUPAC name is (E)-3-[4-[[3',6'-bis(diethylamino)-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]iminomethyl]-N-methylanilino]prop-2-enenitrile.
| Compound Name | (E)-3-[4-[[3',6'-bis(diethylamino)-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]iminomethyl]-N-methylanilino]prop-2-enenitrile |
|---|---|
| PubChem CID | 178180590 |
| Molecular Formula | C39H40N6O2 |
| Molecular Weight | 624.79 g/mol |
| Exact Mass | 624.32 |
| IUPAC Name | (E)-3-[4-[[3',6'-bis(diethylamino)-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]iminomethyl]-N-methylanilino]prop-2-enenitrile |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C21c2ccccc2C(=O)N1N=Cc1ccc(N(C)/C=C/C#N)cc1 |
| InChI | InChI=1S/C39H40N6O2/c1-6-43(7-2)30-19-21-34-36(25-30)47-37-26-31(44(8-3)9-4)20-22-35(37)39(34)33-14-11-10-13-32(33)38(46)45(39)41-27-28-15-17-29(18-16-28)42(5)24-12-23-40/h10-22,24-27H,6-9H2,1-5H3/b24-12+,41-27? |
| InChIKey | LGQSLLWPIIMAQD-LOOQWMRZSA-N |
| XLogP | 7.74 |
| TPSA | 75.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.79 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|