C58H62N8O6 — CID 101429831
N,N'-bis[3',6'-bis(diethylamino)-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]oxamide (PubChem CID 101429831) has the molecular formula C58H62N8O6 and a molecular weight of 967.18 g/mol. Its IUPAC name is N,N'-bis[3',6'-bis(diethylamino)-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]oxamide.
| Compound Name | N,N'-bis[3',6'-bis(diethylamino)-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]oxamide |
|---|---|
| PubChem CID | 101429831 |
| Molecular Formula | C58H62N8O6 |
| Molecular Weight | 967.18 g/mol |
| Exact Mass | 966.48 |
| IUPAC Name | N,N'-bis[3',6'-bis(diethylamino)-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]oxamide |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C21c2ccccc2C(=O)N1NC(=O)C(=O)NN1C(=O)c2ccccc2C12c1ccc(N(CC)CC)cc1Oc1cc(N(CC)CC)ccc12 |
| InChI | InChI=1S/C58H62N8O6/c1-9-61(10-2)37-25-29-45-49(33-37)71-50-34-38(62(11-3)12-4)26-30-46(50)57(45)43-23-19-17-21-41(43)55(69)65(57)59-53(67)54(68)60-66-56(70)42-22-18-20-24-44(42)58(66)47-31-27-39(63(13-5)14-6)35-51(47)72-52-36-40(28-32-48(52)58)64(15-7)16-8/h17-36H,9-16H2,1-8H3,(H,59,67)(H,60,68) |
| InChIKey | XFBVYUDTGVGSNU-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 130.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 967.18 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|