C34H33N7O5 — CID 102528182
3',6'-bis(diethylamino)-2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]spiro[isoindole-3,9'-xanthene]-1-one (PubChem CID 102528182) has the molecular formula C34H33N7O5 and a molecular weight of 619.68 g/mol. Its IUPAC name is 3',6'-bis(diethylamino)-2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]spiro[isoindole-3,9'-xanthene]-1-one.
| Compound Name | 3',6'-bis(diethylamino)-2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]spiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 102528182 |
| Molecular Formula | C34H33N7O5 |
| Molecular Weight | 619.68 g/mol |
| Exact Mass | 619.25 |
| IUPAC Name | 3',6'-bis(diethylamino)-2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]spiro[isoindole-3,9'-xanthene]-1-one |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C21c2ccccc2C(=O)N1Nc1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C34H33N7O5/c1-5-38(6-2)21-13-15-25-29(19-21)45-30-20-22(39(7-3)8-4)14-16-26(30)34(25)24-12-10-9-11-23(24)33(42)40(34)35-27-17-18-28(41(43)44)32-31(27)36-46-37-32/h9-20,35H,5-8H2,1-4H3 |
| InChIKey | XAOOSPKRJINWQH-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 130.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.68 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|