C26H18N2O5 — CID 155404558
3',6'-dihydroxy-2-(2-hydroxyanilino)spiro[isoindole-3,9'-xanthene]-1-one (PubChem CID 155404558) has the molecular formula C26H18N2O5 and a molecular weight of 438.44 g/mol. Its IUPAC name is 3',6'-dihydroxy-2-(2-hydroxyanilino)spiro[isoindole-3,9'-xanthene]-1-one.
| Compound Name | 3',6'-dihydroxy-2-(2-hydroxyanilino)spiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 155404558 |
| Molecular Formula | C26H18N2O5 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 3',6'-dihydroxy-2-(2-hydroxyanilino)spiro[isoindole-3,9'-xanthene]-1-one |
| SMILES | O=C1c2ccccc2C2(c3ccc(O)cc3Oc3cc(O)ccc32)N1Nc1ccccc1O |
| InChI | InChI=1S/C26H18N2O5/c29-15-9-11-19-23(13-15)33-24-14-16(30)10-12-20(24)26(19)18-6-2-1-5-17(18)25(32)28(26)27-21-7-3-4-8-22(21)31/h1-14,27,29-31H |
| InChIKey | OXOSTQJIDDLDCP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|