C33H29NO6 — CID 15883724
benzyl 6-(3',6'-dihydroxy-3-oxospiro[isoindole-1,9'-xanthene]-2-yl)hexanoate (PubChem CID 15883724) has the molecular formula C33H29NO6 and a molecular weight of 535.60 g/mol. Its IUPAC name is benzyl 6-(3',6'-dihydroxy-3-oxospiro[isoindole-1,9'-xanthene]-2-yl)hexanoate.
| Compound Name | benzyl 6-(3',6'-dihydroxy-3-oxospiro[isoindole-1,9'-xanthene]-2-yl)hexanoate |
|---|---|
| PubChem CID | 15883724 |
| Molecular Formula | C33H29NO6 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | benzyl 6-(3',6'-dihydroxy-3-oxospiro[isoindole-1,9'-xanthene]-2-yl)hexanoate |
| SMILES | O=C(CCCCCN1C(=O)c2ccccc2C12c1ccc(O)cc1Oc1cc(O)ccc12)OCc1ccccc1 |
| InChI | InChI=1S/C33H29NO6/c35-23-14-16-27-29(19-23)40-30-20-24(36)15-17-28(30)33(27)26-12-7-6-11-25(26)32(38)34(33)18-8-2-5-13-31(37)39-21-22-9-3-1-4-10-22/h1,3-4,6-7,9-12,14-17,19-20,35-36H,2,5,8,13,18,21H2 |
| InChIKey | NFBPTBSUTZACNF-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|