C31H27N3O5 — CID 172953338
2-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-3',6'-dihydroxyspiro[isoindole-3,9'-xanthene]-1-one (PubChem CID 172953338) has the molecular formula C31H27N3O5 and a molecular weight of 521.57 g/mol. Its IUPAC name is 2-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-3',6'-dihydroxyspiro[isoindole-3,9'-xanthene]-1-one.
| Compound Name | 2-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-3',6'-dihydroxyspiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 172953338 |
| Molecular Formula | C31H27N3O5 |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | 2-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-3',6'-dihydroxyspiro[isoindole-3,9'-xanthene]-1-one |
| SMILES | CCN(CC)c1ccc(/C=N\N2C(=O)c3ccccc3C23c2ccc(O)cc2Oc2cc(O)ccc23)c(O)c1 |
| InChI | InChI=1S/C31H27N3O5/c1-3-33(4-2)20-10-9-19(27(37)15-20)18-32-34-30(38)23-7-5-6-8-24(23)31(34)25-13-11-21(35)16-28(25)39-29-17-22(36)12-14-26(29)31/h5-18,35-37H,3-4H2,1-2H3/b32-18- |
| InChIKey | RUSLUFPLDLXJJV-CAQPMQTCSA-N |
| XLogP | 5.54 |
| TPSA | 105.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|